EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14NO6P |
| Net Charge | 0 |
| Average Mass | 275.197 |
| Monoisotopic Mass | 275.05587 |
| SMILES | CCOP(=O)(OCC)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H14NO6P/c1-3-15-18(14,16-4-2)17-10-7-5-9(6-8-10)11(12)13/h5-8H,3-4H2,1-2H3 |
| InChIKey | WYMSBXTXOHUIGT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paraoxon (CHEBI:27827) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| paraoxon (CHEBI:27827) has role mouse metabolite (CHEBI:75771) |
| paraoxon (CHEBI:27827) is a aryl dialkyl phosphate (CHEBI:37558) |
| paraoxon (CHEBI:27827) is a organophosphate insecticide (CHEBI:25708) |
| IUPAC Name |
|---|
| diethyl 4-nitrophenyl phosphate |
| Synonyms | Source |
|---|---|
| diethyl p-nitrophenyl phosphate | ChemIDplus |
| diethyl paraoxon | UM-BBD |
| O,O-diethyl O-p-nitrophenyl phosphate | ChemIDplus |
| p-nitrophenyl diethyl phosphate | ChemIDplus |
| ethyl paraoxon | ChemIDplus |
| Paraoxon | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| paraoxon | UniProt |
| Citations |
|---|