EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27827 - paraoxon
| Formula | C10H14NO6P |
| Net Charge | 0 |
| Average Mass | 275.197 |
| Monoisotopic Mass | 275.05587 |
| SMILES | CCOP(=O)(OCC)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H14NO6P/c1-3-15-18(14,16-4-2)17-10-7-5-9(6-8-10)11(12)13/h5-8H,3-4H2,1-2H3 |
| InChIKey | WYMSBXTXOHUIGT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paraoxon (CHEBI:27827) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| paraoxon (CHEBI:27827) has role mouse metabolite (CHEBI:75771) |
| paraoxon (CHEBI:27827) is a aryl dialkyl phosphate (CHEBI:37558) |
| paraoxon (CHEBI:27827) is a organophosphate insecticide (CHEBI:25708) |
| IUPAC Name |
|---|
| diethyl 4-nitrophenyl phosphate |
| Synonyms | Source |
|---|---|
| diethyl p-nitrophenyl phosphate | ChemIDplus |
| diethyl paraoxon | UM-BBD |
| O,O-diethyl O-p-nitrophenyl phosphate | ChemIDplus |
| p-nitrophenyl diethyl phosphate | ChemIDplus |
| ethyl paraoxon | ChemIDplus |
| Paraoxon | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| paraoxon | UniProt |
| Citations |
|---|