EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3ccc(OC)c(O)c3)oc2c1 |
| InChI | InChI=1S/C18H16O7/c1-22-10-7-12(20)15-14(8-10)25-17(18(24-3)16(15)21)9-4-5-13(23-2)11(19)6-9/h4-8,19-20H,1-3H3 |
| InChIKey | KPCRYSMUMBNTCK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calycopteris floribunda (ncbitaxon:134915) | - | PubMed (21275386) | Methanol-Dichloromethane (1:1) extract of dried, ground plant material |
| Euodia elleryana (IPNI:772987-1) | - | PubMed (21275386) | MeOH-CH2Cl2(1:1)extract of dried, ground plant material,synonym Euodia is captured instead of Evodia |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',5-dihydroxy-3,4',7-trimethoxyflavone (CHEBI:27825) has functional parent quercetin (CHEBI:16243) |
| 3',5-dihydroxy-3,4',7-trimethoxyflavone (CHEBI:27825) has role plant metabolite (CHEBI:76924) |
| 3',5-dihydroxy-3,4',7-trimethoxyflavone (CHEBI:27825) is a dihydroxyflavone (CHEBI:38686) |
| 3',5-dihydroxy-3,4',7-trimethoxyflavone (CHEBI:27825) is a trimethoxyflavone (CHEBI:27124) |
| 3',5-dihydroxy-3,4',7-trimethoxyflavone (CHEBI:27825) is conjugate acid of 3',5-dihydroxy-3,4',7-trimethoxyflavone(1−) (CHEBI:77770) |
| Incoming Relation(s) |
| 3',5-dihydroxy-3,4',7-trimethoxyflavone(1−) (CHEBI:77770) is conjugate base of 3',5-dihydroxy-3,4',7-trimethoxyflavone (CHEBI:27825) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,7-dimethoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',5-Dihydroxy-3,4',7-trimethoxyflavone | KEGG COMPOUND |
| 3,7,4'-O-trimethylquercetin | ChEBI |
| 3,7,4'-tri-O-methylquercetin | KEGG COMPOUND |