EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23NO5 |
| Net Charge | 0 |
| Average Mass | 369.417 |
| Monoisotopic Mass | 369.15762 |
| SMILES | [H][C@@]12C=C[C@H](OC(C)=O)[C@@H]3Oc4c(OC(C)=O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C21H23NO5/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20/h4-7,14-15,17,20H,8-10H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1 |
| InChIKey | GVGLGOZIDCSQPN-PVHGPHFFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heroin (CHEBI:27808) has functional parent morphine (CHEBI:17303) |
| heroin (CHEBI:27808) has role opioid analgesic (CHEBI:35482) |
| heroin (CHEBI:27808) has role prodrug (CHEBI:50266) |
| heroin (CHEBI:27808) has role μ-opioid receptor agonist (CHEBI:55322) |
| heroin (CHEBI:27808) is a morphinane alkaloid (CHEBI:25418) |
| IUPAC Name |
|---|
| 17-methyl-7,8-didehydro-4,5α-epoxymorphinan-3,6α-diyl diacetate |
| Synonyms | Source |
|---|---|
| 3,6-Diacetylmorphine | ChemIDplus |
| (5α,6α)-7,8-Didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol diacetate (ester) | NIST Chemistry WebBook |
| 7,8-Dihydro-4,5-alpha-epoxy-17-methylmorphinan-3,6-alpha-diol diacetate | ChemIDplus |
| Diacetylmorphine | KEGG COMPOUND |
| Diacetylmorphine | ChemIDplus |
| Diamorphine | KEGG COMPOUND |
| Citations |
|---|