EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23NO5 |
| Net Charge | 0 |
| Average Mass | 369.417 |
| Monoisotopic Mass | 369.15762 |
| SMILES | [H][C@@]12C=C[C@H](OC(C)=O)[C@@H]3Oc4c(OC(C)=O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C21H23NO5/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20/h4-7,14-15,17,20H,8-10H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1 |
| InChIKey | GVGLGOZIDCSQPN-PVHGPHFFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heroin (CHEBI:27808) has functional parent morphine (CHEBI:17303) |
| heroin (CHEBI:27808) has role opioid analgesic (CHEBI:35482) |
| heroin (CHEBI:27808) has role prodrug (CHEBI:50266) |
| heroin (CHEBI:27808) has role μ-opioid receptor agonist (CHEBI:55322) |
| heroin (CHEBI:27808) is a morphinane alkaloid (CHEBI:25418) |
| IUPAC Name |
|---|
| 17-methyl-7,8-didehydro-4,5α-epoxymorphinan-3,6α-diyl diacetate |
| Synonyms | Source |
|---|---|
| Heroin | KEGG COMPOUND |
| Diacetylmorphine | ChemIDplus |
| 3,6-Diacetylmorphine | ChemIDplus |
| 7,8-Dihydro-4,5-alpha-epoxy-17-methylmorphinan-3,6-alpha-diol diacetate | ChemIDplus |
| O,O'-Diacetylmorphine | ChemIDplus |
| (5α,6α)-7,8-Didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol diacetate (ester) | NIST Chemistry WebBook |
| Citations |
|---|