EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2O5 |
| Net Charge | 0 |
| Average Mass | 388.464 |
| Monoisotopic Mass | 388.19982 |
| SMILES | COc1cc(C(=O)NCc2ccc(OCCN(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H28N2O5/c1-23(2)10-11-28-17-8-6-15(7-9-17)14-22-21(24)16-12-18(25-3)20(27-5)19(13-16)26-4/h6-9,12-13H,10-11,14H2,1-5H3,(H,22,24) |
| InChIKey | FEZBIKUBAYAZIU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimethobenzamide (CHEBI:27796) has role antiemetic (CHEBI:50919) |
| trimethobenzamide (CHEBI:27796) is a benzamides (CHEBI:22702) |
| trimethobenzamide (CHEBI:27796) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-{4-[2-(dimethylamino)ethoxy]benzyl}-3,4,5-trimethoxybenzamide |
| INNs | Source |
|---|---|
| trimethobenzamide | ChemIDplus |
| trimethobenzamidum | ChemIDplus |
| trimetobenzamida | ChemIDplus |
| Synonym | Source |
|---|---|
| N-[[4-(2-dimethylaminoethoxy)phenyl]methyl]-3,4,5-trimethoxybenzamide | DrugBank |