EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1O |
| InChI | InChI=1S/C10H10O4/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+ |
| InChIKey | QURCVMIEKCOAJU-HWKANZROSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoferulic acid (CHEBI:27794) has role antioxidant (CHEBI:22586) |
| isoferulic acid (CHEBI:27794) has role biomarker (CHEBI:59163) |
| isoferulic acid (CHEBI:27794) has role metabolite (CHEBI:25212) |
| isoferulic acid (CHEBI:27794) is a ferulic acids (CHEBI:24031) |
| Incoming Relation(s) |
| isovitexin 7-O-[isoferuloyl]-glucoside (CHEBI:75371) has functional parent isoferulic acid (CHEBI:27794) |
| IUPAC Name |
|---|
| (2E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 3-Hydroxy-4-methoxycinnamic acid | HMDB |
| Hesperetic acid | HMDB |
| Citations |
|---|