EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26N4O23P4 |
| Net Charge | 0 |
| Average Mass | 790.307 |
| Monoisotopic Mass | 789.99383 |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4ccc(=O)nc4=O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C18H26N4O23P4/c23-9-1-3-21(17(29)19-9)15-13(27)11(25)7(41-15)5-39-46(31,32)43-48(35,36)45-49(37,38)44-47(33,34)40-6-8-12(26)14(28)16(42-8)22-4-2-10(24)20-18(22)30/h1-4,7-8,11-16,25-28H,5-6H2,(H,31,32)(H,33,34)(H,35,36)(H,37,38)(H,19,23,29)(H,20,24,30)/t7-,8-,11-,12-,13-,14-,15-,16-/m1/s1 |
| InChIKey | NMLMACJWHPHKGR-NCOIDOBVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | P2Y2 receptor agonist A compound that exhibits agonist activity at the P2Y2 receptor. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| P1,P4-bis(uridin-5'-yl) tetraphosphate (CHEBI:27791) has role mouse metabolite (CHEBI:75771) |
| P1,P4-bis(uridin-5'-yl) tetraphosphate (CHEBI:27791) has role P2Y2 receptor agonist (CHEBI:53142) |
| P1,P4-bis(uridin-5'-yl) tetraphosphate (CHEBI:27791) is a pyrimidine ribonucleoside 5'-tetraphosphate (CHEBI:37068) |
| P1,P4-bis(uridin-5'-yl) tetraphosphate (CHEBI:27791) is a uridine 5'-phosphate (CHEBI:27232) |
| INN | Source |
|---|---|
| Diquafosol | ChemIDplus |
| Synonym | Source |
|---|---|
| P1,P4-Bis(5'-uridyl) tetrahydrogen tetraphosphate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10232670 | Beilstein |
| CAS:59985-21-6 | ChemIDplus |