EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H4Cl4O2 |
| Net Charge | 0 |
| Average Mass | 321.974 |
| Monoisotopic Mass | 319.89654 |
| SMILES | Clc1c(Cl)c(Cl)c2c(c1Cl)Oc1ccccc1O2 |
| InChI | InChI=1S/C12H4Cl4O2/c13-7-8(14)10(16)12-11(9(7)15)17-5-3-1-2-4-6(5)18-12/h1-4H |
| InChIKey | DJHHDLMTUOLVHY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,3,4-tetrachlorodibenzodioxine (CHEBI:27785) is a polychlorinated dibenzodioxine (CHEBI:36682) |
| IUPAC Name |
|---|
| 1,2,3,4-tetrachlorooxanthrene |
| Synonyms | Source |
|---|---|
| 1,2,3,4-TCDD | KEGG COMPOUND |
| 1,2,3,4-Tetrachlorodibenzodioxin | KEGG COMPOUND |
| 1,2,3,4-tetrachlorodibenzo[b,e][1,4]dioxin | NIST Chemistry WebBook |
| 1,2,3,4-Tetrachlorodibenzo-para-dioxin | ChemIDplus |
| 1,2,3,4-Tetrachlorodibenzo-p-dioxin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11058 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:30746-58-8 | KEGG COMPOUND |
| CAS:30746-58-8 | NIST Chemistry WebBook |
| CAS:30746-58-8 | ChemIDplus |