EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClO6 |
| Net Charge | 0 |
| Average Mass | 352.770 |
| Monoisotopic Mass | 352.07137 |
| SMILES | COC1=CC(=O)C[C@@H](C)[C@]12Oc1c(Cl)c(OC)cc(OC)c1C2=O |
| InChI | InChI=1S/C17H17ClO6/c1-8-5-9(19)6-12(23-4)17(8)16(20)13-10(21-2)7-11(22-3)14(18)15(13)24-17/h6-8H,5H2,1-4H3/t8-,17+/m1/s1 |
| InChIKey | DDUHZTYCFQRHIY-RBHXEPJQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| griseofulvin (CHEBI:27779) has role Penicillium metabolite (CHEBI:76964) |
| griseofulvin (CHEBI:27779) has role antibacterial agent (CHEBI:33282) |
| griseofulvin (CHEBI:27779) is a 1-benzofurans (CHEBI:38830) |
| griseofulvin (CHEBI:27779) is a antibiotic antifungal drug (CHEBI:87113) |
| griseofulvin (CHEBI:27779) is a benzofuran antifungal drug (CHEBI:87128) |
| griseofulvin (CHEBI:27779) is a organochlorine compound (CHEBI:36683) |
| griseofulvin (CHEBI:27779) is a oxaspiro compound (CHEBI:37948) |
| IUPAC Name |
|---|
| (2S,6'R)-7-chloro-2',4,6-trimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione |
| INNs | Source |
|---|---|
| griseofulvin | KEGG DRUG |
| griseofulvina | ChemIDplus |
| griséofulvine | ChemIDplus |
| griseofulvinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| amudane | NIST Chemistry WebBook |
| (+)-griseofulvin | NIST Chemistry WebBook |
| Griseofulvin | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Curling factor | DrugBank |
| Fulcin | DrugBank |
| Fulvicin | DrugBank |
| Grifulvin | DrugBank |
| Grisactin | DrugBank |
| Grisovin | DrugBank |
| UniProt Name | Source |
|---|---|
| griseofulvin | UniProt |
| Citations |
|---|