EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | COc1cc(O)cc(OC)c1C(C)=O |
| InChI | InChI=1S/C10H12O4/c1-6(11)10-8(13-2)4-7(12)5-9(10)14-3/h4-5,12H,1-3H3 |
| InChIKey | AZRTXUQINTVMDW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',6'-dimethoxy-4'-hydroxyacetophenone (CHEBI:27769) has role plant metabolite (CHEBI:76924) |
| 2',6'-dimethoxy-4'-hydroxyacetophenone (CHEBI:27769) is a dimethoxybenzene (CHEBI:51681) |
| 2',6'-dimethoxy-4'-hydroxyacetophenone (CHEBI:27769) is a monohydroxyacetophenone (CHEBI:25387) |
| 2',6'-dimethoxy-4'-hydroxyacetophenone (CHEBI:27769) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-2,6-dimethoxyphenyl)ethan-1-one |