EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O4Se |
| Net Charge | 0 |
| Average Mass | 269.159 |
| Monoisotopic Mass | 270.01188 |
| SMILES | N[C@@H](CC[Se]C[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H14N2O4Se/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1 |
| InChIKey | ZNWYDQPOUQRDLY-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-selenocystathionine (CHEBI:27760) is a selenocystathionine (CHEBI:26630) |
| L-selenocystathionine (CHEBI:27760) is tautomer of L-selenocystathionine zwitterion (CHEBI:62226) |
| Incoming Relation(s) |
| L-selenocystathionine zwitterion (CHEBI:62226) is tautomer of L-selenocystathionine (CHEBI:27760) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-{[(2R)-2-amino-2-carboxyethyl]selanyl}butanoic acid |
| Synonym | Source |
|---|---|
| L,L-selenocystathionine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05699 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2371675 | Reaxys |
| Citations |
|---|