EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O |
| Net Charge | 0 |
| Average Mass | 208.260 |
| Monoisotopic Mass | 208.08882 |
| SMILES | COc1cccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C15H12O/c1-16-15-8-4-7-13-12-6-3-2-5-11(12)9-10-14(13)15/h2-10H,1H3 |
| InChIKey | ONMKCYMMGBIVPT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methoxyphenanthrene (CHEBI:27753) has role mouse metabolite (CHEBI:75771) |
| 1-methoxyphenanthrene (CHEBI:27753) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 1-methoxyphenanthrene |
| Synonyms | Source |
|---|---|
| 1-Methoxyphenanthrene | KEGG COMPOUND |
| methyl 1-phenanthryl ether | IUPAC |