EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16N4O2 |
| Net Charge | 0 |
| Average Mass | 188.231 |
| Monoisotopic Mass | 188.12733 |
| SMILES | N=C(N)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H16N4O2/c8-5(6(12)13)3-1-2-4-11-7(9)10/h5H,1-4,8H2,(H,12,13)(H4,9,10,11)/t5-/m0/s1 |
| InChIKey | QUOGESRFPZDMMT-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lathyrus cicera (ncbitaxon:3856) | - | PubMed (24954190) | |
| Lathyrus sativus (ncbitaxon:3860) | - | PubMed (24954190) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (26676627) | |
| Trypanosoma brucei brucei (ncbitaxon:5702) | |||
| - | MetaboLights (MTBLS49) | Strain: WT427 | |
| - | PubMed (23571546) | Strain: WT427 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. EC 3.1.3.1 (alkaline phosphatase) inhibitor An EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor that interferes with the action of alkaline phosphatase (EC 3.1.3.1). rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homoarginine (CHEBI:27747) has role biomarker (CHEBI:59163) |
| L-homoarginine (CHEBI:27747) has role EC 3.1.3.1 (alkaline phosphatase) inhibitor (CHEBI:63332) |
| L-homoarginine (CHEBI:27747) has role human metabolite (CHEBI:77746) |
| L-homoarginine (CHEBI:27747) has role rat metabolite (CHEBI:86264) |
| L-homoarginine (CHEBI:27747) has role xenobiotic metabolite (CHEBI:76206) |
| L-homoarginine (CHEBI:27747) is a L-lysine derivative (CHEBI:25095) |
| L-homoarginine (CHEBI:27747) is a homoarginine (CHEBI:24606) |
| L-homoarginine (CHEBI:27747) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-homoarginine (CHEBI:27747) is conjugate base of L-homoarginine(1+) (CHEBI:143006) |
| Incoming Relation(s) |
| L-homoarginine(1+) (CHEBI:143006) is conjugate acid of L-homoarginine (CHEBI:27747) |
| IUPAC Name |
|---|
| N6-carbamimidoyl-L-lysine |
| Synonyms | Source |
|---|---|
| Homoarginine | KEGG COMPOUND |
| Homo-L-arginine | HMDB |
| N6-amidino-L-Lysine | HMDB |
| N6-amidino-Lysine | HMDB |
| N6-(Aminoiminomethyl)-L-lysine | HMDB |
| L-N6-amidinolysine | ChemIDplus |
| Citations |
|---|