EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:27704 |
| ChEBI Name | S-hexylglutathione |
| Stars | |
| ASCII Name | S-hexylglutathione |
| Definition | An S-substituted glutathione that is glutathione in which the hydrogen of the thiol has been replaced by a hexyl group (PDB entry: 1PN9). |
| Secondary ChEBI IDs | CHEBI:8960, CHEBI:22051, CHEBI:43014 |
| Last Modified | 20 September 2019 |
| Downloads |
| Formula | C16H29N3O6S |
| Net Charge | 0 |
| Average Mass | 391.490 |
| Monoisotopic Mass | 391.17771 |
| SMILES | CCCCCCSC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C16H29N3O6S/c1-2-3-4-5-8-26-10-12(15(23)18-9-14(21)22)19-13(20)7-6-11(17)16(24)25/h11-12H,2-10,17H2,1H3,(H,18,23)(H,19,20)(H,21,22)(H,24,25)/t11-,12-/m0/s1 |
| InChIKey | HXJDWCWJDCOHDG-RYUDHWBXSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-hexylglutathione (CHEBI:27704) is a S-substituted glutathione (CHEBI:17021) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-hexyl-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| Hexylglutathione | ChemIDplus |
| S-Hexyl-glutathione | KEGG COMPOUND |
| S-Hexyl-L-glutathione | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5629635 | Beilstein |
| CAS:24425-56-7 | KEGG COMPOUND |
| CAS:24425-56-7 | ChemIDplus |