EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O9 |
| Net Charge | 0 |
| Average Mass | 460.439 |
| Monoisotopic Mass | 460.14818 |
| SMILES | [H][C@@]12[C@@H](O)[C@@]3([H])C(=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@H]2N(C)C)C(=O)c1c(O)cccc1[C@@]3(C)O |
| InChI | InChI=1S/C22H24N2O9/c1-21(32)7-5-4-6-8(25)9(7)15(26)10-12(21)17(28)13-14(24(2)3)16(27)11(20(23)31)19(30)22(13,33)18(10)29/h4-6,12-14,17,25,27-29,32-33H,1-3H3,(H2,23,31)/t12-,13-,14+,17+,21-,22+/m1/s1 |
| InChIKey | IWVCMVBTMGNXQD-PXOLEDIWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces rimosus (ncbitaxon:1927) | - | PubMed (1833366) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxytetracycline (CHEBI:27701) has role anti-inflammatory drug (CHEBI:35472) |
| oxytetracycline (CHEBI:27701) has role antibacterial agent (CHEBI:33282) |
| oxytetracycline (CHEBI:27701) has role antibacterial drug (CHEBI:36047) |
| oxytetracycline (CHEBI:27701) has role antiinfective agent (CHEBI:35441) |
| oxytetracycline (CHEBI:27701) has role antimicrobial agent (CHEBI:33281) |
| oxytetracycline (CHEBI:27701) has role bacterial metabolite (CHEBI:76969) |
| oxytetracycline (CHEBI:27701) has role ophthalmology drug (CHEBI:66981) |
| oxytetracycline (CHEBI:27701) has role protein synthesis inhibitor (CHEBI:48001) |
| oxytetracycline (CHEBI:27701) is a tetracyclines (CHEBI:26895) |
| oxytetracycline (CHEBI:27701) is tautomer of oxytetracycline zwitterion (CHEBI:133011) |
| Incoming Relation(s) |
| oxytetracycline zwitterion (CHEBI:133011) is tautomer of oxytetracycline (CHEBI:27701) |
| IUPAC Name |
|---|
| (4S,4aR,5S,5aR,6S,12aS)-4-(dimethylamino)-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| oxitetraciclina | ChemIDplus |
| oxytetracyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Hydroxytetracycline | ChemIDplus |
| 5-hydroxytetracycline dihydrate | ChEMBL |
| E703 | ChEMBL |
| Nitox | ChEMBL |
| NSC-757262 | ChEMBL |
| NSC-9169 | ChEMBL |
| Brand Names | Source |
|---|---|
| Berkmycen | ChEMBL |
| Chemocycline | ChEMBL |
| Galenomycin | ChEMBL |
| Hi-tet | ChEMBL |
| Imperacin | ChEMBL |
| Microtet | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2041 | DrugCentral |
| 503 | BPDB |
| 503 | VSDB |
| C00017127 | KNApSAcK |
| C06624 | KEGG COMPOUND |
| DB00595 | DrugBank |
| HMDB0014733 | HMDB |
| LMPK07000005 | LIPID MAPS |
| oxytetracycline | Alan Wood's Pesticides |
| Oxytetracycline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2686362 | Beilstein |
| Reaxys:2714587 | Reaxys |
| Gmelin:623487 | Gmelin |
| CAS:79-57-2 | KEGG COMPOUND |
| CAS:79-57-2 | ChemIDplus |
| Citations |
|---|