EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O9 |
| Net Charge | 0 |
| Average Mass | 460.439 |
| Monoisotopic Mass | 460.14818 |
| SMILES | [H][C@@]12[C@@H](O)[C@@]3([H])C(=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@H]2N(C)C)C(=O)c1c(O)cccc1[C@@]3(C)O |
| InChI | InChI=1S/C22H24N2O9/c1-21(32)7-5-4-6-8(25)9(7)15(26)10-12(21)17(28)13-14(24(2)3)16(27)11(20(23)31)19(30)22(13,33)18(10)29/h4-6,12-14,17,25,27-29,32-33H,1-3H3,(H2,23,31)/t12-,13-,14+,17+,21-,22+/m1/s1 |
| InChIKey | IWVCMVBTMGNXQD-PXOLEDIWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces rimosus (ncbitaxon:1927) | - | PubMed (1833366) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxytetracycline (CHEBI:27701) has role anti-inflammatory drug (CHEBI:35472) |
| oxytetracycline (CHEBI:27701) has role antibacterial drug (CHEBI:36047) |
| oxytetracycline (CHEBI:27701) has role antimicrobial agent (CHEBI:33281) |
| oxytetracycline (CHEBI:27701) has role bacterial metabolite (CHEBI:76969) |
| oxytetracycline (CHEBI:27701) has role protein synthesis inhibitor (CHEBI:48001) |
| oxytetracycline (CHEBI:27701) is a tetracyclines (CHEBI:26895) |
| oxytetracycline (CHEBI:27701) is tautomer of oxytetracycline zwitterion (CHEBI:133011) |
| Incoming Relation(s) |
| oxytetracycline zwitterion (CHEBI:133011) is tautomer of oxytetracycline (CHEBI:27701) |
| IUPAC Name |
|---|
| (4S,4aR,5S,5aR,6S,12aS)-4-(dimethylamino)-3,5,6,10,12,12a-hexahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| oxitetraciclina | ChemIDplus |
| oxytetracyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Hydroxytetracycline | ChemIDplus |
| Oxyterracin | ChemIDplus |
| Oxyterracine | ChemIDplus |
| Oxytetracyclin | ChemIDplus |
| Oxytetracycline amphoteric | ChemIDplus |
| Oxytetracycline (anhydrous) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2041 | DrugCentral |
| 503 | VSDB |
| 503 | BPDB |
| C00017127 | KNApSAcK |
| C06624 | KEGG COMPOUND |
| DB00595 | DrugBank |
| HMDB0014733 | HMDB |
| LMPK07000005 | LIPID MAPS |
| oxytetracycline | Alan Wood's Pesticides |
| Oxytetracycline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2686362 | Beilstein |
| Reaxys:2714587 | Reaxys |
| Gmelin:623487 | Gmelin |
| CAS:79-57-2 | KEGG COMPOUND |
| CAS:79-57-2 | ChemIDplus |
| Citations |
|---|