EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O5 |
| Net Charge | 0 |
| Average Mass | 354.487 |
| Monoisotopic Mass | 354.24062 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C(=O)C[C@H](O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-18,21-22H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,18-/m0/s1 |
| InChIKey | CIMMACURCPXICP-PNQRDDRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin D1 (CHEBI:27696) has role human metabolite (CHEBI:77746) |
| prostaglandin D1 (CHEBI:27696) is a prostaglandins D (CHEBI:26337) |
| prostaglandin D1 (CHEBI:27696) is conjugate acid of prostaglandin D1(1−) (CHEBI:79010) |
| Incoming Relation(s) |
| prostaglandin D1(1−) (CHEBI:79010) is conjugate base of prostaglandin D1 (CHEBI:27696) |
| IUPAC Name |
|---|
| (13E,15S)-9α,15-dihydroxy-11-oxoprost-13-en-1-oic acid |
| Synonyms | Source |
|---|---|
| 5-Hydroxy-2-(3-hydroxy-1-octenyl)-3-oxocyclopentaneheptanoic acid | ChemIDplus |
| PGD1 | ChemIDplus |
| Prostaglandin D1 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06438 | KEGG COMPOUND |
| LMFA03010049 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:17968-82-0 | KEGG COMPOUND |
| CAS:17968-82-0 | ChemIDplus |