EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N4O3S2 |
| Net Charge | 0 |
| Average Mass | 222.251 |
| Monoisotopic Mass | 221.98813 |
| SMILES | CC(=O)Nc1nnc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C4H6N4O3S2/c1-2(9)6-3-7-8-4(12-3)13(5,10)11/h1H3,(H2,5,10,11)(H,6,7,9) |
| InChIKey | BZKPWHYZMXOIDC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 4.2.1.1 (carbonic anhydrase) inhibitor An EC 4.2.1.* (hydro-lyases) inhibitor that interferes with the action of carbonic anhydrase (EC 4.2.1.1). Such compounds reduce the secretion of H+ ions by the proximal kidney tubule. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. diuretic An agent that promotes the excretion of urine through its effects on kidney function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetazolamide (CHEBI:27690) has parent hydride 1,3,4-thiadiazole (CHEBI:39472) |
| acetazolamide (CHEBI:27690) has role anticonvulsant (CHEBI:35623) |
| acetazolamide (CHEBI:27690) has role diuretic (CHEBI:35498) |
| acetazolamide (CHEBI:27690) has role EC 4.2.1.1 (carbonic anhydrase) inhibitor (CHEBI:23018) |
| acetazolamide (CHEBI:27690) is a monocarboxylic acid amide (CHEBI:29347) |
| acetazolamide (CHEBI:27690) is a sulfonamide (CHEBI:35358) |
| acetazolamide (CHEBI:27690) is a thiadiazoles (CHEBI:38099) |
| acetazolamide (CHEBI:27690) is conjugate acid of acetazolamide(1−) (CHEBI:50634) |
| Incoming Relation(s) |
| acetazolamide sodium (CHEBI:31163) has part acetazolamide (CHEBI:27690) |
| acetazolamide(1−) (CHEBI:50634) is conjugate base of acetazolamide (CHEBI:27690) |
| IUPAC Name |
|---|
| N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
| INNs | Source |
|---|---|
| acetazolamida | ChemIDplus |
| acétazolamide | ChEBI |
| acetazolamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-acetylamino-1,3,4-thiadiazole-5-sulfonamide | NIST Chemistry WebBook |
| 5-ACETAMIDO-1,3,4-THIADIAZOLE-2-SULFONAMIDE | PDBeChem |
| 5-acetylamino-1,3,4-thiadiazole-2-sulfonamide | ChEBI |
| Acetazolamide | KEGG COMPOUND |
| Diamox | ChemIDplus |
| N-[5-(aminosulfonyl)-1,3,4-thiadiazol-2-yl]acetamide | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Defiltran | DrugBank |
| Diacarb | DrugBank |
| Diluran | DrugBank |
| Glaupax | DrugBank |