EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O5 |
| Net Charge | 0 |
| Average Mass | 298.294 |
| Monoisotopic Mass | 298.08412 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(OC)cc3o2)cc1 |
| InChI | InChI=1S/C17H14O5/c1-20-11-5-3-10(4-6-11)15-9-14(19)17-13(18)7-12(21-2)8-16(17)22-15/h3-9,18H,1-2H3 |
| InChIKey | LZERJKGWTQYMBB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apigenin 7,4'-dimethyl ether (CHEBI:2769) has functional parent apigenin (CHEBI:18388) |
| apigenin 7,4'-dimethyl ether (CHEBI:2769) has role plant metabolite (CHEBI:76924) |
| apigenin 7,4'-dimethyl ether (CHEBI:2769) is a dimethoxyflavone (CHEBI:23798) |
| apigenin 7,4'-dimethyl ether (CHEBI:2769) is a monohydroxyflavone (CHEBI:38687) |
| IUPAC Name |
|---|
| 5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 4,7-dimethoxy-5-hydroxyflavone | ChemIDplus |
| 4',7-dimethylapigenin | ChemIDplus |
| Apigenin dimethylether | KEGG COMPOUND |
| genkwanin 4'-methyl ether | ChemIDplus |
| UniProt Name | Source |
|---|---|
| apigenin 4',7-dimethyl ether | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00001016 | KNApSAcK |
| C10019 | KEGG COMPOUND |
| LMPK12111029 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:295742 | Reaxys |
| CAS:5128-44-9 | KEGG COMPOUND |
| CAS:5128-44-9 | ChemIDplus |
| Citations |
|---|