EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19O2 |
| Net Charge | -1 |
| Average Mass | 171.260 |
| Monoisotopic Mass | 171.13905 |
| SMILES | CCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)/p-1 |
| InChIKey | GHVNFZFCNZKVNT-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decanoate (CHEBI:27689) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| decanoate (CHEBI:27689) has role human metabolite (CHEBI:77746) |
| decanoate (CHEBI:27689) has role plant metabolite (CHEBI:76924) |
| decanoate (CHEBI:27689) is a fatty acid anion 10:0 (CHEBI:78118) |
| decanoate (CHEBI:27689) is a medium-chain fatty acid anion (CHEBI:59558) |
| decanoate (CHEBI:27689) is a straight-chain saturated fatty acid anion (CHEBI:58954) |
| decanoate (CHEBI:27689) is a ω-methyl-medium-chain fatty acid anion (CHEBI:194240) |
| decanoate (CHEBI:27689) is conjugate base of decanoic acid (CHEBI:30813) |
| Incoming Relation(s) |
| N-decanoyl-3-ketodihydrosphingosine (CHEBI:189538) has functional parent decanoate (CHEBI:27689) |
| N6-capryl-L-lysine residue (CHEBI:143222) has functional parent decanoate (CHEBI:27689) |
| O-decanoyl-L-serine residue (CHEBI:143549) has functional parent decanoate (CHEBI:27689) |
| O-decanoyl-L-threonine residue (CHEBI:143546) has functional parent decanoate (CHEBI:27689) |
| 2-oxodecanotate (CHEBI:176592) has functional parent decanoate (CHEBI:27689) |
| decanoic acid (CHEBI:30813) is conjugate acid of decanoate (CHEBI:27689) |
| IUPAC Name |
|---|
| decanoate |
| Synonyms | Source |
|---|---|
| caprate | ChEBI |
| caprinate | ChEBI |
| nC9H19CO2 anion | NIST Chemistry WebBook |
| CH3‒[CH2]8‒COO− | IUPAC |
| n-decanoate | ChEBI |
| caprynate | ChEBI |
| UniProt Name | Source |
|---|---|
| decanoate | UniProt |