EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27671 - cis,trans-muconic acid
| Formula | C6H6O4 |
| Net Charge | 0 |
| Average Mass | 142.110 |
| Monoisotopic Mass | 142.02661 |
| SMILES | O=C(O)/C=C\C=C\C(=O)O |
| InChI | InChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/b3-1-,4-2+ |
| InChIKey | TXXHDPDFNKHHGW-HSFFGMMNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis,trans-muconic acid (CHEBI:27671) is a muconic acid (CHEBI:38407) |
| cis,trans-muconic acid (CHEBI:27671) is conjugate acid of cis,trans-muconate (CHEBI:27031) |
| Incoming Relation(s) |
| (E,E)-3-chloromuconic acid (CHEBI:38432) has functional parent cis,trans-muconic acid (CHEBI:27671) |
| (Z,Z)-3-chloromuconic acid (CHEBI:38435) has functional parent cis,trans-muconic acid (CHEBI:27671) |
| cis,trans-muconate (CHEBI:27031) is conjugate base of cis,trans-muconic acid (CHEBI:27671) |
| IUPAC Name |
|---|
| (2Z,4E)-hexa-2,4-dienedioic acid |
| Manual Xrefs | Databases |
|---|---|
| C03647 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1722247 | Beilstein |