EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27662 - benzquinamide
| Formula | C22H32N2O5 |
| Net Charge | 0 |
| Average Mass | 404.507 |
| Monoisotopic Mass | 404.23112 |
| SMILES | CCN(CC)C(=O)C1CN2CCc3cc(OC)c(OC)cc3C2CC1OC(C)=O |
| InChI | InChI=1S/C22H32N2O5/c1-6-23(7-2)22(26)17-13-24-9-8-15-10-20(27-4)21(28-5)11-16(15)18(24)12-19(17)29-14(3)25/h10-11,17-19H,6-9,12-13H2,1-5H3 |
| InChIKey | JSZILQVIPPROJI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzquinamide (CHEBI:27662) has role antiemetic (CHEBI:50919) |
| benzquinamide (CHEBI:27662) has role antipsychotic agent (CHEBI:35476) |
| benzquinamide (CHEBI:27662) has role H1-receptor antagonist (CHEBI:37955) |
| benzquinamide (CHEBI:27662) has role muscarinic antagonist (CHEBI:48876) |
| benzquinamide (CHEBI:27662) has role sedative (CHEBI:35717) |
| benzquinamide (CHEBI:27662) is a monocarboxylic acid amide (CHEBI:29347) |
| Incoming Relation(s) |
| (2R,3S,11bS)-benzquinamide (CHEBI:36382) is a benzquinamide (CHEBI:27662) |
| (2S,3S,11bS)-benzquinamide (CHEBI:36381) is a benzquinamide (CHEBI:27662) |
| IUPAC Name |
|---|
| 3-(diethylcarbamoyl)-9,10-dimethoxy-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-yl acetate |
| INNs | Source |
|---|---|
| benzquinamida | ChEBI |
| benzquinamide | ChEBI |
| benzquinamidum | ChEBI |
| Synonyms | Source |
|---|---|
| benzquinamide | NIST Chemistry WebBook |
| Emete-Con | NIST Chemistry WebBook |
| BZQ | NIST Chemistry WebBook |
| 2-(acetyloxy)-N,N-diethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2H-benzo[a]quinolizine-3-carboxamide | NIST Chemistry WebBook |
| 2-(acetoxy)-N,N-diethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2H-benzo[a]quinolizine-3-carboxamide | ChEBI |
| Benzchinamid | ChEBI |