EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32N2O5 |
| Net Charge | 0 |
| Average Mass | 404.507 |
| Monoisotopic Mass | 404.23112 |
| SMILES | CCN(CC)C(=O)C1CN2CCc3cc(OC)c(OC)cc3C2CC1OC(C)=O |
| InChI | InChI=1S/C22H32N2O5/c1-6-23(7-2)22(26)17-13-24-9-8-15-10-20(27-4)21(28-5)11-16(15)18(24)12-19(17)29-14(3)25/h10-11,17-19H,6-9,12-13H2,1-5H3 |
| InChIKey | JSZILQVIPPROJI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzquinamide (CHEBI:27662) has role antiemetic (CHEBI:50919) |
| benzquinamide (CHEBI:27662) has role antipsychotic agent (CHEBI:35476) |
| benzquinamide (CHEBI:27662) has role H1-receptor antagonist (CHEBI:37955) |
| benzquinamide (CHEBI:27662) has role muscarinic antagonist (CHEBI:48876) |
| benzquinamide (CHEBI:27662) has role sedative (CHEBI:35717) |
| benzquinamide (CHEBI:27662) is a monocarboxylic acid amide (CHEBI:29347) |
| Incoming Relation(s) |
| (2R,3S,11bS)-benzquinamide (CHEBI:36382) is a benzquinamide (CHEBI:27662) |
| (2S,3S,11bS)-benzquinamide (CHEBI:36381) is a benzquinamide (CHEBI:27662) |
| IUPAC Name |
|---|
| 3-(diethylcarbamoyl)-9,10-dimethoxy-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-yl acetate |
| INNs | Source |
|---|---|
| benzquinamida | ChEBI |
| benzquinamide | ChEBI |
| benzquinamidum | ChEBI |
| Synonyms | Source |
|---|---|
| 2-(acetoxy)-N,N-diethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2H-benzo[a]quinolizine-3-carboxamide | ChEBI |
| 2-(acetyloxy)-N,N-diethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2H-benzo[a]quinolizine-3-carboxamide | NIST Chemistry WebBook |
| Benzchinamid | ChEBI |
| Benzchinamide | ChEMBL |
| benzochinamide | ChemIDplus |
| benzquinamide | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Quantril | ChEMBL |
| Citations |
|---|