EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO6 |
| Net Charge | 0 |
| Average Mass | 231.204 |
| Monoisotopic Mass | 231.07429 |
| SMILES | [H]C(=O)CC[C@H](NC(=O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H13NO6/c11-5-1-2-6(9(15)16)10-7(12)3-4-8(13)14/h5-6H,1-4H2,(H,10,12)(H,13,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | XTOKIEIBKARFSZ-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-succinyl-L-glutamic 5-semialdehyde (CHEBI:27657) has functional parent L-glutamic 5-semialdehyde (CHEBI:17232) |
| N-succinyl-L-glutamic 5-semialdehyde (CHEBI:27657) has functional parent succinic acid (CHEBI:15741) |
| N-succinyl-L-glutamic 5-semialdehyde (CHEBI:27657) has role Escherichia coli metabolite (CHEBI:76971) |
| N-succinyl-L-glutamic 5-semialdehyde (CHEBI:27657) is a dicarboxylic acid monoamide (CHEBI:35735) |
| N-succinyl-L-glutamic 5-semialdehyde (CHEBI:27657) is a glutamic semialdehyde (CHEBI:24313) |
| N-succinyl-L-glutamic 5-semialdehyde (CHEBI:27657) is conjugate acid of N-succinyl-L-glutamic 5-semialdehyde(2−) (CHEBI:58520) |
| Incoming Relation(s) |
| N-succinyl-L-glutamic 5-semialdehyde(2−) (CHEBI:58520) is conjugate base of N-succinyl-L-glutamic 5-semialdehyde (CHEBI:27657) |
| IUPAC Name |
|---|
| (2S)-2-[(3-carboxypropanoyl)amino]-5-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-(3-Carboxypropanoylamino)-5-oxopentanoic acid | KEGG COMPOUND |
| N-(3-carboxypropanoyl)-5-oxo-L-norvaline | ChEBI |
| N-Succinyl-L-glutamate 5-semialdehyde | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05932 | KEGG COMPOUND |