EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23ClN2O8 |
| Net Charge | 0 |
| Average Mass | 478.885 |
| Monoisotopic Mass | 478.11429 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)ccc(Cl)c1[C@@]2(C)O |
| InChI | InChI=1S/C22H23ClN2O8/c1-21(32)7-6-8-15(25(2)3)17(28)13(20(24)31)19(30)22(8,33)18(29)11(7)16(27)12-10(26)5-4-9(23)14(12)21/h4-5,7-8,15,26,28-29,32-33H,6H2,1-3H3,(H2,24,31)/t7-,8-,15-,21-,22-/m0/s1 |
| InChIKey | CYDMQBQPVICBEU-XRNKAMNCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces aureofaciens (ncbitaxon:1894) | - | PubMed (Ann. N.Y. Acad. Sci., 1948, v51, 177) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlortetracycline (CHEBI:27644) has role antibacterial agent (CHEBI:33282) |
| chlortetracycline (CHEBI:27644) has role antibacterial drug (CHEBI:36047) |
| chlortetracycline (CHEBI:27644) has role antiinfective agent (CHEBI:35441) |
| chlortetracycline (CHEBI:27644) has role antiprotozoal drug (CHEBI:35820) |
| chlortetracycline (CHEBI:27644) has role calcium ionophore (CHEBI:22986) |
| chlortetracycline (CHEBI:27644) has role fluorescent probe (CHEBI:39442) |
| chlortetracycline (CHEBI:27644) has role ophthalmology drug (CHEBI:66981) |
| chlortetracycline (CHEBI:27644) is a monocarboxylic acid amide (CHEBI:29347) |
| chlortetracycline (CHEBI:27644) is a monochlorobenzenes (CHEBI:83403) |
| chlortetracycline (CHEBI:27644) is a tertiary alcohol (CHEBI:26878) |
| chlortetracycline (CHEBI:27644) is a tertiary amino compound (CHEBI:50996) |
| chlortetracycline (CHEBI:27644) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| chlortetracycline (CHEBI:27644) is a tetracyclines (CHEBI:26895) |
| chlortetracycline (CHEBI:27644) is conjugate acid of chlortetracycline(1−) (CHEBI:133598) |
| Incoming Relation(s) |
| chlortetracycline(1−) (CHEBI:133598) is conjugate base of chlortetracycline (CHEBI:27644) |
| IUPAC Name |
|---|
| (4S,4aS,5aS,6S,12aS)-7-chloro-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| chlortetracycline | WHO MedNet |
| chlortétracycline | WHO MedNet |
| chlortetracyclinum | WHO MedNet |
| clortetraciclina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 7-Chlorotetracycline | KEGG COMPOUND |
| Chlorotetracycline | ChEMBL |
| E702 | ChEMBL |
| Brand Name | Source |
|---|---|
| Aueromycin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 624 | DrugCentral |
| C06571 | KEGG COMPOUND |
| CTC | PDBeChem |
| D07689 | KEGG DRUG |
| HMDB0014401 | HMDB |
| LMPK07000004 | LIPID MAPS |
| US2482055 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:57-62-5 | ChemIDplus |
| CAS:57-62-5 | KEGG COMPOUND |
| Citations |
|---|