EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23ClN2O8 |
| Net Charge | 0 |
| Average Mass | 478.885 |
| Monoisotopic Mass | 478.11429 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)ccc(Cl)c1[C@@]2(C)O |
| InChI | InChI=1S/C22H23ClN2O8/c1-21(32)7-6-8-15(25(2)3)17(28)13(20(24)31)19(30)22(8,33)18(29)11(7)16(27)12-10(26)5-4-9(23)14(12)21/h4-5,7-8,15,26,28-29,32-33H,6H2,1-3H3,(H2,24,31)/t7-,8-,15-,21-,22-/m0/s1 |
| InChIKey | CYDMQBQPVICBEU-XRNKAMNCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces aureofaciens (ncbitaxon:1894) | - | PubMed (Ann. N.Y. Acad. Sci., 1948, v51, 177) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial drug A drug used to treat or prevent bacterial infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. antibacterial drug A drug used to treat or prevent bacterial infections. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlortetracycline (CHEBI:27644) has role antibacterial agent (CHEBI:33282) |
| chlortetracycline (CHEBI:27644) has role antibacterial drug (CHEBI:36047) |
| chlortetracycline (CHEBI:27644) has role antiinfective agent (CHEBI:35441) |
| chlortetracycline (CHEBI:27644) has role antiprotozoal drug (CHEBI:35820) |
| chlortetracycline (CHEBI:27644) has role calcium ionophore (CHEBI:22986) |
| chlortetracycline (CHEBI:27644) has role fluorescent probe (CHEBI:39442) |
| chlortetracycline (CHEBI:27644) has role ophthalmology drug (CHEBI:66981) |
| chlortetracycline (CHEBI:27644) is a monocarboxylic acid amide (CHEBI:29347) |
| chlortetracycline (CHEBI:27644) is a monochlorobenzenes (CHEBI:83403) |
| chlortetracycline (CHEBI:27644) is a tertiary alcohol (CHEBI:26878) |
| chlortetracycline (CHEBI:27644) is a tertiary amino compound (CHEBI:50996) |
| chlortetracycline (CHEBI:27644) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| chlortetracycline (CHEBI:27644) is a tetracyclines (CHEBI:26895) |
| chlortetracycline (CHEBI:27644) is conjugate acid of chlortetracycline(1−) (CHEBI:133598) |
| Incoming Relation(s) |
| chlortetracycline(1−) (CHEBI:133598) is conjugate base of chlortetracycline (CHEBI:27644) |
| IUPAC Name |
|---|
| (4S,4aS,5aS,6S,12aS)-7-chloro-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| chlortetracycline | WHO MedNet |
| chlortétracycline | WHO MedNet |
| chlortetracyclinum | WHO MedNet |
| clortetraciclina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 7-Chlorotetracycline | KEGG COMPOUND |
| Chlorotetracycline | ChEMBL |
| E702 | ChEMBL |
| Brand Name | Source |
|---|---|
| Aueromycin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 624 | DrugCentral |
| C06571 | KEGG COMPOUND |
| CTC | PDBeChem |
| D07689 | KEGG DRUG |
| HMDB0014401 | HMDB |
| LMPK07000004 | LIPID MAPS |
| US2482055 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:57-62-5 | ChemIDplus |
| CAS:57-62-5 | KEGG COMPOUND |
| Citations |
|---|