EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23NO4 |
| Net Charge | 0 |
| Average Mass | 281.352 |
| Monoisotopic Mass | 281.16271 |
| SMILES | [H][C@@]1([C@H](O)CC2CC(=O)NC(=O)C2)C[C@@H](C)C[C@H](C)C1=O |
| InChI | InChI=1S/C15H23NO4/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10/h8-12,17H,3-7H2,1-2H3,(H,16,18,19)/t8-,9-,11-,12+/m0/s1 |
| InChIKey | YPHMISFOHDHNIV-FSZOTQKASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cycloheximide (CHEBI:27641) has functional parent piperidine-2,6-dione (CHEBI:5435) |
| cycloheximide (CHEBI:27641) has role anticoronaviral agent (CHEBI:149553) |
| cycloheximide (CHEBI:27641) has role bacterial metabolite (CHEBI:76969) |
| cycloheximide (CHEBI:27641) has role ferroptosis inhibitor (CHEBI:173084) |
| cycloheximide (CHEBI:27641) has role neuroprotective agent (CHEBI:63726) |
| cycloheximide (CHEBI:27641) has role protein synthesis inhibitor (CHEBI:48001) |
| cycloheximide (CHEBI:27641) is a antibiotic fungicide (CHEBI:87114) |
| cycloheximide (CHEBI:27641) is a cyclic ketone (CHEBI:3992) |
| cycloheximide (CHEBI:27641) is a dicarboximide (CHEBI:35356) |
| cycloheximide (CHEBI:27641) is a piperidine antibiotic (CHEBI:49318) |
| cycloheximide (CHEBI:27641) is a piperidones (CHEBI:48589) |
| cycloheximide (CHEBI:27641) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 4-{(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl}piperidine-2,6-dione |
| INNs | Source |
|---|---|
| cicloheximida | ChemIDplus |
| cicloheximide | WHO MedNet |
| cicloheximide | WHO MedNet |
| cicloheximidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-((R)-2-((1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl)-2-hydroxyethyl)glutarimide | ChemIDplus |
| Cycloheximid | ChEBI |
| Cycloheximide | KEGG COMPOUND |
| naramycin | ChemIDplus |
| naramycin A | ChemIDplus |
| Zykloheximid | ChEBI |
| UniProt Name | Source |
|---|---|
| cycloheximide | UniProt |
| Citations |
|---|