EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2762 - antimycin A
| Formula | C28H40N2O9 |
| Net Charge | 0 |
| Average Mass | 548.633 |
| Monoisotopic Mass | 548.27338 |
| SMILES | [H]C(=O)Nc1cccc(C(=O)N[C@@H]2C(=O)O[C@@H](C)[C@H](OC(=O)CC(C)C)[C@@H](CCCCCC)C(=O)O[C@@H]2C)c1O |
| InChI | InChI=1S/C28H40N2O9/c1-6-7-8-9-11-20-25(39-22(32)14-16(2)3)18(5)38-28(36)23(17(4)37-27(20)35)30-26(34)19-12-10-13-21(24(19)33)29-15-31/h10,12-13,15-18,20,23,25,33H,6-9,11,14H2,1-5H3,(H,29,31)(H,30,34)/t17-,18+,20-,23+,25+/m1/s1 |
| InChIKey | UIFFUZWRFRDZJC-SBOOETFBSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | piscicide A substance which is poisonous to fish and is primarily used to eliminate dominant species of fish in water. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antimycin A (CHEBI:2762) has role antifungal agent (CHEBI:35718) |
| antimycin A (CHEBI:2762) has role mitochondrial respiratory-chain inhibitor (CHEBI:25355) |
| antimycin A (CHEBI:2762) has role piscicide (CHEBI:167183) |
| antimycin A (CHEBI:2762) is a benzamides (CHEBI:22702) |
| antimycin A (CHEBI:2762) is a formamides (CHEBI:24079) |
| antimycin A (CHEBI:2762) is a macrodiolide (CHEBI:145556) |
| antimycin A (CHEBI:2762) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl 3-methylbutanoate |
| Synonyms | Source |
|---|---|
| Antimycin A1 | KEGG COMPOUND |
| antimycin A1b | ChEBI |
| Antipiricullin | ChemIDplus |
| Fintrol | ChemIDplus |
| Virosin | ChemIDplus |
| Citations |
|---|