EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H62O11 |
| Net Charge | 0 |
| Average Mass | 670.881 |
| Monoisotopic Mass | 670.42921 |
| SMILES | [H][C@]1([C@@H](C)[C@@H](OC)[C@H](C)C(=O)O)O[C@@]2(CC[C@@](C)([C@@]3([H])CC[C@@](CC)([C@]4([H])O[C@@]([H])([C@@]5([H])O[C@@](O)(CO)[C@H](C)C[C@@H]5C)C[C@@H]4C)O3)O2)C[C@H](O)[C@H]1C |
| InChI | InChI=1S/C36H62O11/c1-10-34(31-20(3)16-26(43-31)28-19(2)15-21(4)36(41,18-37)46-28)12-11-27(44-34)33(8)13-14-35(47-33)17-25(38)22(5)30(45-35)23(6)29(42-9)24(7)32(39)40/h19-31,37-38,41H,10-18H2,1-9H3,(H,39,40)/t19-,20-,21+,22+,23-,24-,25-,26+,27+,28-,29+,30-,31+,33-,34-,35+,36-/m0/s1 |
| InChIKey | GAOZTHIDHYLHMS-KEOBGNEYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | ionophore A compound which can carry specific ions through membranes of cells or organelles. coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monensin A (CHEBI:27617) has role antifungal agent (CHEBI:35718) |
| monensin A (CHEBI:27617) has role coccidiostat (CHEBI:35818) |
| monensin A (CHEBI:27617) has role ionophore (CHEBI:24869) |
| monensin A (CHEBI:27617) is a cyclic hemiketal (CHEBI:59780) |
| monensin A (CHEBI:27617) is a monocarboxylic acid (CHEBI:25384) |
| monensin A (CHEBI:27617) is a polyether antibiotic (CHEBI:26179) |
| monensin A (CHEBI:27617) is a spiroketal (CHEBI:72600) |
| IUPAC Name |
|---|
| (2S,3R,4S)-4-[(2S,5R,7S,8R,9S)-2-{(2S,2'R,3'S,5R,5'R)-2-ethyl-5'-[(2S,3S,5R,6R)-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyltetrahydro-2H-pyran-2-yl]-3'-methyloctahydro-2,2'-bifuran-5-yl}-9-hydroxy-2,8-dimethyl-1,6-dioxaspiro[4.5]dec-7-yl]-3-methoxy-2-methylpentanoic acid |
| INNs | Source |
|---|---|
| monensinum | ChemIDplus |
| monensina | ChemIDplus |
| monensin | ChemIDplus |
| Synonyms | Source |
|---|---|
| Monensin | KEGG COMPOUND |
| monensic acid | ChemIDplus |
| Monensin A | KEGG COMPOUND |
| Citations |
|---|