EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H62O11 |
| Net Charge | 0 |
| Average Mass | 670.881 |
| Monoisotopic Mass | 670.42921 |
| SMILES | [H][C@]1([C@@H](C)[C@@H](OC)[C@H](C)C(=O)O)O[C@@]2(CC[C@@](C)([C@@]3([H])CC[C@@](CC)([C@]4([H])O[C@@]([H])([C@@]5([H])O[C@@](O)(CO)[C@H](C)C[C@@H]5C)C[C@@H]4C)O3)O2)C[C@H](O)[C@H]1C |
| InChI | InChI=1S/C36H62O11/c1-10-34(31-20(3)16-26(43-31)28-19(2)15-21(4)36(41,18-37)46-28)12-11-27(44-34)33(8)13-14-35(47-33)17-25(38)22(5)30(45-35)23(6)29(42-9)24(7)32(39)40/h19-31,37-38,41H,10-18H2,1-9H3,(H,39,40)/t19-,20-,21+,22+,23-,24-,25-,26+,27+,28-,29+,30-,31+,33-,34-,35+,36-/m0/s1 |
| InChIKey | GAOZTHIDHYLHMS-KEOBGNEYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. ionophore A compound which can carry specific ions through membranes of cells or organelles. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monensin A (CHEBI:27617) has role antifungal agent (CHEBI:35718) |
| monensin A (CHEBI:27617) has role coccidiostat (CHEBI:35818) |
| monensin A (CHEBI:27617) has role ionophore (CHEBI:24869) |
| monensin A (CHEBI:27617) is a cyclic hemiketal (CHEBI:59780) |
| monensin A (CHEBI:27617) is a monocarboxylic acid (CHEBI:25384) |
| monensin A (CHEBI:27617) is a polyether antibiotic (CHEBI:26179) |
| monensin A (CHEBI:27617) is a spiroketal (CHEBI:72600) |
| IUPAC Name |
|---|
| (2S,3R,4S)-4-[(2S,5R,7S,8R,9S)-2-{(2S,2'R,3'S,5R,5'R)-2-ethyl-5'-[(2S,3S,5R,6R)-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyltetrahydro-2H-pyran-2-yl]-3'-methyloctahydro-2,2'-bifuran-5-yl}-9-hydroxy-2,8-dimethyl-1,6-dioxaspiro[4.5]dec-7-yl]-3-methoxy-2-methylpentanoic acid |
| INNs | Source |
|---|---|
| monensin | ChemIDplus |
| monensina | ChemIDplus |
| monensinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| monensic acid | ChemIDplus |
| Monensin | KEGG COMPOUND |
| Monensin A | KEGG COMPOUND |
| Citations |
|---|