EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H38N4O8 |
| Net Charge | 0 |
| Average Mass | 654.720 |
| Monoisotopic Mass | 654.26896 |
| SMILES | CC1=C(CCC(=O)O)c2cc3nc(cc4nc(cc5nc(cc1n2)c(CCC(=O)O)c5C)C(C)=C4CCC(=O)O)c(CCC(=O)O)c3C |
| InChI | InChI=1S/C36H38N4O8/c1-17-21(5-9-33(41)42)29-14-27-19(3)22(6-10-34(43)44)30(39-27)15-28-20(4)24(8-12-36(47)48)32(40-28)16-31-23(7-11-35(45)46)18(2)26(38-31)13-25(17)37-29/h13-16,37,40H,5-12H2,1-4H3,(H,41,42)(H,43,44)(H,45,46)(H,47,48)/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16- |
| InChIKey | JWFCYWSMNRLXLX-UJJXFSCMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coproporphyrin III (CHEBI:27609) has role human metabolite (CHEBI:77746) |
| coproporphyrin III (CHEBI:27609) is a coproporphyrin (CHEBI:23388) |
| coproporphyrin III (CHEBI:27609) is conjugate acid of coproporphyrin III(4−) (CHEBI:131725) |
| Incoming Relation(s) |
| coproporphyrin III(4−) (CHEBI:131725) is conjugate base of coproporphyrin III (CHEBI:27609) |
| Synonyms | Source |
|---|---|
| 3,8,13,17-tetramethylporphyrin-2,7,12,18-tetrapropanoic acid | JCBN |
| Coproporphyrin III | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05770 | KEGG COMPOUND |
| C05770 | KEGG COMPOUND |
| COPROPORPHYRIN_III | MetaCyc |
| DB04461 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:14643-66-4 | KEGG COMPOUND |