EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6O5 |
| Net Charge | 0 |
| Average Mass | 182.131 |
| Monoisotopic Mass | 182.02152 |
| SMILES | O=C(O)c1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C8H6O5/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3,9H,(H,10,11)(H,12,13) |
| InChIKey | MWRVRCAFWBBXTL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxyphthalic acid (CHEBI:27600) has functional parent phthalic acid (CHEBI:29069) |
| 4-hydroxyphthalic acid (CHEBI:27600) is a hydroxybenzoic acid (CHEBI:24676) |
| 4-hydroxyphthalic acid (CHEBI:27600) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-hydroxybenzene-1,2-dicarboxylic acid |