EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O4 |
| Net Charge | 0 |
| Average Mass | 184.191 |
| Monoisotopic Mass | 184.07356 |
| SMILES | COc1cc(O)cc(OC)c1OC |
| InChI | InChI=1S/C9H12O4/c1-11-7-4-6(10)5-8(12-2)9(7)13-3/h4-5,10H,1-3H3 |
| InChIKey | VTCDZPUMZAZMSB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4,5-trimethoxyphenol (CHEBI:2760) has role plant metabolite (CHEBI:76924) |
| 3,4,5-trimethoxyphenol (CHEBI:2760) is a methoxybenzenes (CHEBI:51683) |
| 3,4,5-trimethoxyphenol (CHEBI:2760) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| albibrissinoside A (CHEBI:65378) has functional parent 3,4,5-trimethoxyphenol (CHEBI:2760) |
| IUPAC Name |
|---|
| 3,4,5-trimethoxyphenol |
| Synonyms | Source |
|---|---|
| 3,4,5-Trimethoxyphenol | KEGG COMPOUND |
| Antiarol | KEGG COMPOUND |