EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27597 - 3-(5-hydroxyindol-3-yl)pyruvic acid
| Formula | C11H9NO4 |
| Net Charge | 0 |
| Average Mass | 219.196 |
| Monoisotopic Mass | 219.05316 |
| SMILES | O=C(O)C(=O)Cc1cnc2ccc(O)cc12 |
| InChI | InChI=1S/C11H9NO4/c13-7-1-2-9-8(4-7)6(5-12-9)3-10(14)11(15)16/h1-2,4-5,12-13H,3H2,(H,15,16) |
| InChIKey | HKNXPMPZYQXTDD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(5-hydroxyindol-3-yl)pyruvic acid (CHEBI:27597) has functional parent pyruvic acid (CHEBI:32816) |
| 3-(5-hydroxyindol-3-yl)pyruvic acid (CHEBI:27597) has role rat metabolite (CHEBI:86264) |
| 3-(5-hydroxyindol-3-yl)pyruvic acid (CHEBI:27597) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 3-(5-hydroxyindol-3-yl)pyruvic acid (CHEBI:27597) is a hydroxyindoles (CHEBI:84729) |
| 3-(5-hydroxyindol-3-yl)pyruvic acid (CHEBI:27597) is a indol-3-yl carboxylic acid (CHEBI:24810) |
| 3-(5-hydroxyindol-3-yl)pyruvic acid (CHEBI:27597) is conjugate acid of 3-(5-hydroxyindol-3-yl)pyruvate (CHEBI:195180) |
| Incoming Relation(s) |
| 3-(5-hydroxyindol-3-yl)pyruvate (CHEBI:195180) is conjugate base of 3-(5-hydroxyindol-3-yl)pyruvic acid (CHEBI:27597) |
| IUPAC Name |
|---|
| 3-(5-hydroxy-1H-indol-3-yl)-2-oxopropanoic acid |
| Synonym | Source |
|---|---|
| 5-hydroxyindolepyruvic acid | KEGG COMPOUND |
| Citations |
|---|