EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O2 |
| Net Charge | 0 |
| Average Mass | 169.184 |
| Monoisotopic Mass | 169.08513 |
| SMILES | Cn1cncc1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H11N3O2/c1-10-4-9-3-5(10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | JDHILDINMRGULE-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24009031) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nπ-methyl-L-histidine (CHEBI:27596) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| Nπ-methyl-L-histidine (CHEBI:27596) has role human metabolite (CHEBI:77746) |
| Nπ-methyl-L-histidine (CHEBI:27596) is a L-histidine derivative (CHEBI:84076) |
| Nπ-methyl-L-histidine (CHEBI:27596) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Nπ-methyl-L-histidine (CHEBI:27596) is tautomer of Nπ-methyl-L-histidine zwitterion (CHEBI:143076) |
| Incoming Relation(s) |
| Nπ-methyl-L-histidine residue (CHEBI:43903) is substituent group from Nπ-methyl-L-histidine (CHEBI:27596) |
| Nπ-methyl-L-histidine zwitterion (CHEBI:143076) is tautomer of Nπ-methyl-L-histidine (CHEBI:27596) |
| IUPAC Name |
|---|
| Nπ-methyl-L-histidine |
| Synonyms | Source |
|---|---|
| N(pai)-Methyl-L-histidine | KEGG COMPOUND |
| 1-Methylhistidine | KEGG COMPOUND |
| (2S)-2-amino-3-(1-methyl-1H-imidazol-5-yl)propanoic acid | IUPAC |
| 3-methylhistidine | ChemIDplus |
| 3-Methylhistidine | KEGG COMPOUND |
| N-pros-Methyl-L-histidine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01152 | KEGG COMPOUND |
| MHS | PDBeChem |
| HMDB0000479 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1568650 | Gmelin |
| Reaxys:83651 | Reaxys |
| CAS:368-16-1 | ChemIDplus |
| CAS:368-16-1 | KEGG COMPOUND |
| Citations |
|---|