EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O2 |
| Net Charge | 0 |
| Average Mass | 142.158 |
| Monoisotopic Mass | 142.07423 |
| SMILES | CC1=N[C@H](C(=O)O)CCN1 |
| InChI | InChI=1S/C6H10N2O2/c1-4-7-3-2-5(8-4)6(9)10/h5H,2-3H2,1H3,(H,7,8)(H,9,10)/t5-/m0/s1 |
| InChIKey | WQXNXVUDBPYKBA-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | osmolyte A solute used by a cell under water stress to maintain cell volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ectoine (CHEBI:27592) has role osmolyte (CHEBI:25728) |
| ectoine (CHEBI:27592) is a 1,4,5,6-tetrahydropyrimidines (CHEBI:78715) |
| ectoine (CHEBI:27592) is a carboxamidine (CHEBI:35359) |
| ectoine (CHEBI:27592) is a monocarboxylic acid (CHEBI:25384) |
| ectoine (CHEBI:27592) is conjugate acid of ectoinate (CHEBI:63475) |
| ectoine (CHEBI:27592) is tautomer of ectoine zwitterion (CHEBI:58515) |
| Incoming Relation(s) |
| ectoinate (CHEBI:63475) is conjugate base of ectoine (CHEBI:27592) |
| ectoine zwitterion (CHEBI:58515) is tautomer of ectoine (CHEBI:27592) |
| IUPAC Name |
|---|
| (4S)-2-methyl-1,4,5,6-tetrahydropyrimidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| Ectoine | KEGG COMPOUND |
| (+)-1,4,5,6-tetrahydro-2-methyl-4-pyrimidinecarboxylic acid | ChemIDplus |
| L-ectoine | ChEBI |
| L-Ectoine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7288977 | Reaxys |
| CAS:96702-03-3 | ChemIDplus |
| CAS:96702-03-3 | KEGG COMPOUND |