EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O12 |
| Net Charge | 0 |
| Average Mass | 578.526 |
| Monoisotopic Mass | 578.14243 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2 |
| InChI | InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27+,28-,29-/m1/s1 |
| InChIKey | XFZJEEAOWLFHDH-VUGKQVTMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procyanidin B4 (CHEBI:27589) has functional parent (+)-catechin (CHEBI:15600) |
| procyanidin B4 (CHEBI:27589) has functional parent (−)-epicatechin (CHEBI:90) |
| procyanidin B4 (CHEBI:27589) has role antineoplastic agent (CHEBI:35610) |
| procyanidin B4 (CHEBI:27589) has role antioxidant (CHEBI:22586) |
| procyanidin B4 (CHEBI:27589) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| procyanidin B4 (CHEBI:27589) is a hydroxyflavan (CHEBI:72010) |
| procyanidin B4 (CHEBI:27589) is a proanthocyanidin (CHEBI:26267) |
| Incoming Relation(s) |
| procyanidin B4 3-O-gallate (CHEBI:75663) has functional parent procyanidin B4 (CHEBI:27589) |
| procyanidin B4 3'-O-gallate (CHEBI:75655) has functional parent procyanidin B4 (CHEBI:27589) |
| IUPAC Name |
|---|
| (2R,2'R,3S,3'R,4S)-2,2'-bis(3,4-dihydroxyphenyl)-3,3',4,4'-tetrahydro-2H,2'H-4,8'-bichromene-3,3',5,5',7,7'-hexol |
| Synonyms | Source |
|---|---|
| Procyanidin B4 | KEGG COMPOUND |
| catechin-(4α→8)-epicatechin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10238 | KEGG COMPOUND |
| Procyanidin_B4 | Wikipedia |
| LMPK12030004 | LIPID MAPS |
| HMDB0013690 | HMDB |
| WO2010021935 | Patent |
| US2010047372 | Patent |
| C00002935 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3647174 | Reaxys |
| CAS:29106-51-2 | KEGG COMPOUND |
| CAS:29106-51-2 | ChemIDplus |
| Citations |
|---|