EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | O=C1c2ccc(O)cc2O[C@H](c2ccc(O)cc2)[C@H]1O |
| InChI | InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)15-14(19)13(18)11-6-5-10(17)7-12(11)20-15/h1-7,14-17,19H/t14-,15+/m0/s1 |
| InChIKey | VRTGGIJPIYOHGT-LSDHHAIUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimutagen An agent that reduces or interferes with the mutagenic actions or effects of a substance. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| garbanzol (CHEBI:27587) has role antimutagen (CHEBI:73190) |
| garbanzol (CHEBI:27587) has role metabolite (CHEBI:25212) |
| garbanzol (CHEBI:27587) is a 4'-hydroxyflavanones (CHEBI:140331) |
| garbanzol (CHEBI:27587) is a dihydroflavonols (CHEBI:48039) |
| garbanzol (CHEBI:27587) is a secondary α-hydroxy ketone (CHEBI:2468) |
| garbanzol (CHEBI:27587) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2R,3R)-3,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3,7,4'-Trihydroxyflavanone | KEGG COMPOUND |
| Garbanzol | KEGG COMPOUND |
| Citations |
|---|