EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | O=C1c2ccc(O)cc2O[C@H](c2ccc(O)cc2)[C@H]1O |
| InChI | InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)15-14(19)13(18)11-6-5-10(17)7-12(11)20-15/h1-7,14-17,19H/t14-,15+/m0/s1 |
| InChIKey | VRTGGIJPIYOHGT-LSDHHAIUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimutagen An agent that reduces or interferes with the mutagenic actions or effects of a substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| garbanzol (CHEBI:27587) has role antimutagen (CHEBI:73190) |
| garbanzol (CHEBI:27587) has role metabolite (CHEBI:25212) |
| garbanzol (CHEBI:27587) is a 4'-hydroxyflavanones (CHEBI:140331) |
| garbanzol (CHEBI:27587) is a dihydroflavonols (CHEBI:48039) |
| garbanzol (CHEBI:27587) is a secondary α-hydroxy ketone (CHEBI:2468) |
| garbanzol (CHEBI:27587) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2R,3R)-3,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3,7,4'-Trihydroxyflavanone | KEGG COMPOUND |
| Garbanzol | KEGG COMPOUND |
| Citations |
|---|