EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N2O2 |
| Net Charge | 0 |
| Average Mass | 128.131 |
| Monoisotopic Mass | 128.05858 |
| SMILES | N#CCCC(N)C(=O)O |
| InChI | InChI=1S/C5H8N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-2,7H2,(H,8,9) |
| InChIKey | VZSTVUJXUYNIOQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-amino-γ-cyanobutanoic acid (CHEBI:27578) has functional parent butyric acid (CHEBI:30772) |
| α-amino-γ-cyanobutanoic acid (CHEBI:27578) is a aliphatic nitrile (CHEBI:80291) |
| α-amino-γ-cyanobutanoic acid (CHEBI:27578) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| 5-nitrilonorvaline |
| Synonyms | Source |
|---|---|
| 2-Amino-4-cyanobutanoic acid | KEGG COMPOUND |
| α-amino-γ-cyanobutyric acid | ChEBI |
| 2-amino-4-cyanobutyric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05717 | KEGG COMPOUND |
| LMFA01100038 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2351718 | Reaxys |