EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O5 |
| Net Charge | 0 |
| Average Mass | 232.236 |
| Monoisotopic Mass | 232.10592 |
| SMILES | NCCC[C@H](NC(=O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O5/c10-5-1-2-6(9(15)16)11-7(12)3-4-8(13)14/h6H,1-5,10H2,(H,11,12)(H,13,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | VWXQFHJBQHTHMK-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-succinyl-L-ornithine (CHEBI:27574) has role Escherichia coli metabolite (CHEBI:76971) |
| N2-succinyl-L-ornithine (CHEBI:27574) is a N2-acyl-L-ornithine (CHEBI:21815) |
| N2-succinyl-L-ornithine (CHEBI:27574) is conjugate acid of N2-succinyl-L-ornithinate(1−) (CHEBI:58514) |
| Incoming Relation(s) |
| N2-succinyl-L-ornithinate(1−) (CHEBI:58514) is conjugate base of N2-succinyl-L-ornithine (CHEBI:27574) |
| IUPAC Name |
|---|
| N2-(3-carboxypropanoyl)-L-ornithine |
| Synonyms | Source |
|---|---|
| (2S)-5-Amino-2-(3-carboxypropanoylamino)pentanoic acid | KEGG COMPOUND |
| N2-Succinyl-L-ornithine | KEGG COMPOUND |