EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O5 |
| Net Charge | 0 |
| Average Mass | 340.375 |
| Monoisotopic Mass | 340.13107 |
| SMILES | CC(C)=CCc1c(O)cc2c(c1O)C(=O)C[C@@H](c1ccc(O)cc1)O2 |
| InChI | InChI=1S/C20H20O5/c1-11(2)3-8-14-15(22)9-18-19(20(14)24)16(23)10-17(25-18)12-4-6-13(21)7-5-12/h3-7,9,17,21-22,24H,8,10H2,1-2H3/t17-/m0/s1 |
| InChIKey | YHWNASRGLKJRJJ-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Biological Role: | T-type calcium channel blocker Any agent that interferes with the activity of T-type calcium channels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-prenylnaringenin (CHEBI:27566) has functional parent (S)-naringenin (CHEBI:17846) |
| 6-prenylnaringenin (CHEBI:27566) has role T-type calcium channel blocker (CHEBI:194338) |
| 6-prenylnaringenin (CHEBI:27566) is a (2S)-flavan-4-one (CHEBI:140377) |
| 6-prenylnaringenin (CHEBI:27566) is a 4'-hydroxyflavanones (CHEBI:140331) |
| 6-prenylnaringenin (CHEBI:27566) is a trihydroxyflavanone (CHEBI:38739) |
| Synonyms | Source |
|---|---|
| (2S)-2,3-dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| sophoraflavanone B | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00000997 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6233280 | Reaxys |
| CAS:68236-13-5 | ChemIDplus |
| Citations |
|---|