EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O5 |
| Net Charge | 0 |
| Average Mass | 256.213 |
| Monoisotopic Mass | 256.03717 |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(O)c(O)c2O |
| InChI | InChI=1S/C14H8O5/c15-9-5-8-10(14(19)13(9)18)12(17)7-4-2-1-3-6(7)11(8)16/h1-5,15,18-19H |
| InChIKey | AHKDJQYHVWSRLT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anthragallol (CHEBI:2755) has role plant metabolite (CHEBI:76924) |
| anthragallol (CHEBI:2755) is a trihydroxyanthraquinone (CHEBI:37488) |
| IUPAC Name |
|---|
| 1,2,3-trihydroxyanthracene-9,10-dione |
| Synonyms | Source |
|---|---|
| Anthragallol | KEGG COMPOUND |
| 1,2,3-trihydroxy-9,10-anthraquinone | IUPAC |
| 1,2,3-trihydroxy-9,10-anthracenedione | ChemIDplus |
| 1,2,3-trihydroxyanthraquinone | ChemIDplus |
| anthragallic acid | ChemIDplus |
| Citations |
|---|