EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27547 - zeaxanthin
| Formula | C40H56O2 |
| Net Charge | 0 |
| Average Mass | 568.886 |
| Monoisotopic Mass | 568.42803 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C[C@@H](O)CC2(C)C)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-24,35-36,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36-/m1/s1 |
| InChIKey | JKQXZKUSFCKOGQ-QAYBQHTQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hormoscilla (ncbitaxon:881023) | - | PubMed (21473610) | CH2Cl2/MeOH(2:1) extract of assemblage of two cyanobacteria, Oscillatoria sp. and Hormoscilla sp. |
| Oscillatoria sp. (ncbitaxon:1159) | - | PubMed (21473610) | CH2Cl2/MeOH(2:1) extract of assemblage of two cyanobacteria, Oscillatoria sp. and Hormoscilla sp. |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zeaxanthin (CHEBI:27547) has parent hydride β-carotene (CHEBI:17579) |
| zeaxanthin (CHEBI:27547) has role antiglaucoma drug (CHEBI:39456) |
| zeaxanthin (CHEBI:27547) has role antineoplastic agent (CHEBI:35610) |
| zeaxanthin (CHEBI:27547) has role antioxidant (CHEBI:22586) |
| zeaxanthin (CHEBI:27547) has role bacterial metabolite (CHEBI:76969) |
| zeaxanthin (CHEBI:27547) has role cofactor (CHEBI:23357) |
| zeaxanthin (CHEBI:27547) is a carotenol (CHEBI:23045) |
| Incoming Relation(s) |
| thermozeaxanthin-17 (CHEBI:80207) has functional parent zeaxanthin (CHEBI:27547) |
| zeaxanthin bis(β-D-glucoside) (CHEBI:63067) has functional parent zeaxanthin (CHEBI:27547) |
| IUPAC Name |
|---|
| (3R,3'R)-β,β-carotene-3,3'-diol |
| Synonyms | Source |
|---|---|
| (3R,3'R)-dihydroxy-β,β-carotene | ChEBI |
| African marigold flower | ChEMBL |
| anchovyxanthin | ChEBI |
| Aztec marigold flower | ChEMBL |
| Aztec marigold zeaxanthin extract | ChEMBL |
| Big marigold flower | ChEMBL |
| UniProt Name | Source |
|---|---|
| all-trans-zeaxanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000931 | KNApSAcK |
| C06098 | KEGG COMPOUND |
| CPD1F-130 | MetaCyc |
| LMPR01070261 | LIPID MAPS |
| Zeaxanthin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2068416 | Beilstein |
| CAS:144-68-3 | ChemIDplus |
| CAS:144-68-3 | KEGG COMPOUND |