EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3Br2O3 |
| Net Charge | -1 |
| Average Mass | 294.906 |
| Monoisotopic Mass | 292.84544 |
| SMILES | O=C([O-])c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C7H4Br2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12)/p-1 |
| InChIKey | PHWAJJWKNLWZGJ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dibromo-4-hydroxybenzoate (CHEBI:27544) has functional parent 2,6-dibromophenol (CHEBI:19391) |
| 3,5-dibromo-4-hydroxybenzoate (CHEBI:27544) has functional parent benzoate (CHEBI:16150) |
| 3,5-dibromo-4-hydroxybenzoate (CHEBI:27544) is a monohydroxybenzoate (CHEBI:25388) |
| 3,5-dibromo-4-hydroxybenzoate (CHEBI:27544) is conjugate base of 3,5-dibromo-4-hydroxybenzoic acid (CHEBI:1395) |
| Incoming Relation(s) |
| 3,5-dibromo-4-hydroxybenzoic acid (CHEBI:1395) is conjugate acid of 3,5-dibromo-4-hydroxybenzoate (CHEBI:27544) |
| IUPAC Name |
|---|
| 3,5-dibromo-4-hydroxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| c0509 | UM-BBD |
| Registry Numbers | Sources |
|---|---|
| CAS:3337-62-0 | UM-BBD |