EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O4 |
| Net Charge | 0 |
| Average Mass | 148.158 |
| Monoisotopic Mass | 148.07356 |
| SMILES | CC[C@@](C)(O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C6H12O4/c1-3-6(2,10)4(7)5(8)9/h4,7,10H,3H2,1-2H3,(H,8,9)/t4-,6+/m0/s1 |
| InChIKey | PDGXJDXVGMHUIR-UJURSFKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3R)-2,3-dihydroxy-3-methylpentanoic acid (CHEBI:27512) has functional parent valeric acid (CHEBI:17418) |
| (2R,3R)-2,3-dihydroxy-3-methylpentanoic acid (CHEBI:27512) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| (2R,3R)-2,3-dihydroxy-3-methylpentanoic acid (CHEBI:27512) is conjugate acid of (2R,3R)-2,3-dihydroxy-3-methylpentanoate (CHEBI:49258) |
| Incoming Relation(s) |
| (2R,3R)-2,3-dihydroxy-3-methylpentanoate (CHEBI:49258) is conjugate base of (2R,3R)-2,3-dihydroxy-3-methylpentanoic acid (CHEBI:27512) |
| IUPAC Names |
|---|
| (2R,3R)-2,3-dihydroxy-3-methylpentanoic acid |
| 4,5-dideoxy-3-C-methyl-D-erythro-pentonic acid |
| Synonym | Source |
|---|---|
| (2R,3R)-2,3-dihydroxy-3-methylvaleric acid | ChEBI |