EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O6 |
| Net Charge | 0 |
| Average Mass | 370.401 |
| Monoisotopic Mass | 370.14164 |
| SMILES | COc1c(C2COc3cc(O)cc(O)c3C2=O)ccc(O)c1CC=C(C)C |
| InChI | InChI=1S/C21H22O6/c1-11(2)4-5-14-16(23)7-6-13(21(14)26-3)15-10-27-18-9-12(22)8-17(24)19(18)20(15)25/h4,6-9,15,22-24H,5,10H2,1-3H3 |
| InChIKey | AALISTBXLBQUEH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus velezensis (ncbitaxon:492670) | - | PubMed (34250503) | Found in cell-free supernatant. Strain: AP203 |
| Echinosophora koreensis (ncbitaxon:228658) | rhizome (BTO:0001181) | PubMed (19557362) | |
| Morus indica (ncbitaxon:248361) | leaf (BTO:0000713) | PubMed (31619703) | |
| Sophora flavescens (ncbitaxon:49840) | - | PubMed (34367714) |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sophoraisoflavanone A (CHEBI:27494) has role antimicrobial agent (CHEBI:33281) |
| sophoraisoflavanone A (CHEBI:27494) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| sophoraisoflavanone A (CHEBI:27494) has role plant metabolite (CHEBI:76924) |
| sophoraisoflavanone A (CHEBI:27494) is a hydroxyisoflavanone (CHEBI:72739) |
| sophoraisoflavanone A (CHEBI:27494) is a methoxyisoflavanone (CHEBI:72740) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-[4-hydroxy-2-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,7-dihydroxy-3-[4-hydroxy-2-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-2,3-dihydro-4H-1-benzopyran-4-one | IUPAC |
| Sophoraisoflavanone A | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002573 | KNApSAcK |
| C10530 | KEGG COMPOUND |
| LMPK12050480 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1667139 | Reaxys |
| CAS:69573-59-7 | KEGG COMPOUND |
| Citations |
|---|