EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O3 |
| Net Charge | 0 |
| Average Mass | 266.381 |
| Monoisotopic Mass | 266.18819 |
| SMILES | COC(=O)/C=C(\C)CC/C=C(\C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C16H26O3/c1-12(9-10-14-16(3,4)19-14)7-6-8-13(2)11-15(17)18-5/h7,11,14H,6,8-10H2,1-5H3/b12-7+,13-11+/t14-/m1/s1 |
| InChIKey | QVJMXSGZTCGLHZ-HONBPKQLSA-N |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| juvenile hormone III (CHEBI:27493) is a enoate ester (CHEBI:51702) |
| juvenile hormone III (CHEBI:27493) is a epoxide (CHEBI:32955) |
| juvenile hormone III (CHEBI:27493) is a fatty acid methyl ester (CHEBI:4986) |
| juvenile hormone III (CHEBI:27493) is a juvenile hormone (CHEBI:24943) |
| IUPAC Name |
|---|
| methyl (2E,6E)-9-[(2R)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoate |
| Synonyms | Source |
|---|---|
| (10R)-Juvenile hormone III | ChemIDplus |
| JH III | ChemIDplus |
| Juvenile hormone 3 | ChemIDplus |
| (+)-Juvenile hormone III | ChemIDplus |
| Methyl 10,11-epoxy-3,7,11-trimethyl-trans,trans-(10R)-2,6-dodecadienoate | ChemIDplus |
| Methyl 10,11-epoxy-3,7,11-trimethyl-trans,trans-2,6-dodecadienoate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| juvenile hormone III | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003157 | KNApSAcK |
| C09694 | KEGG COMPOUND |
| CPD-8838 | MetaCyc |
| JH3 | PDBeChem |
| LMPR0103010004 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4453965 | Reaxys |
| CAS:22963-93-5 | KEGG COMPOUND |
| CAS:22963-93-5 | ChemIDplus |
| Citations |
|---|