EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H38N4O16 |
| Net Charge | 0 |
| Average Mass | 830.756 |
| Monoisotopic Mass | 830.22828 |
| SMILES | O=C(O)CCC1=C(CC(=O)O)c2cc3nc(cc4nc(cc5nc(cc1n2)c(CC(=O)O)c5CCC(=O)O)C(CC(=O)O)=C4CCC(=O)O)c(CC(=O)O)c3CCC(=O)O |
| InChI | InChI=1S/C40H38N4O16/c45-33(46)5-1-17-21(9-37(53)54)29-14-26-19(3-7-35(49)50)23(11-39(57)58)31(43-26)16-28-20(4-8-36(51)52)24(12-40(59)60)32(44-28)15-27-18(2-6-34(47)48)22(10-38(55)56)30(42-27)13-25(17)41-29/h13-16,41,44H,1-12H2,(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60)/b25-13-,26-14-,27-15-,28-16-,29-14-,30-13-,31-16-,32-15- |
| InChIKey | DAFUFNRZWDWXJP-JRHDEHKPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| uroporphyrin I (CHEBI:27484) has role human metabolite (CHEBI:77746) |
| uroporphyrin I (CHEBI:27484) is a uroporphyrin (CHEBI:27259) |
| uroporphyrin I (CHEBI:27484) is conjugate acid of uroporphyrin I(8−) (CHEBI:167480) |
| Incoming Relation(s) |
| uroporphyrin I(8−) (CHEBI:167480) is conjugate base of uroporphyrin I (CHEBI:27484) |
| IUPAC Name |
|---|
| 3,8,13,18-tetrakis(carboxymethyl)porphyrin-2,7,12,17-tetrapropanoic acid |
| Synonyms | Source |
|---|---|
| 2,7,12,17-porphinetetrapropionic acid | ChEBI |
| 3,8,13,18-tetrakis(carboxymethyl)porphyrin-2,7,12,17-tetrapropionic acid | JCBN |
| Uroporphyrin I | KEGG COMPOUND |