EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO5 |
| Net Charge | 0 |
| Average Mass | 211.173 |
| Monoisotopic Mass | 211.04807 |
| SMILES | O=C/C=C1/C=C(C(=O)O)N[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C9H9NO5/c11-2-1-5-3-6(8(12)13)10-7(4-5)9(14)15/h1-3,7,10H,4H2,(H,12,13)(H,14,15)/b5-1-/t7-/m0/s1 |
| InChIKey | YQDKULBMDMPFLH-FSRBREEPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| betalamic acid (CHEBI:27483) is a betalain (CHEBI:22861) |
| betalamic acid (CHEBI:27483) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (2S,4E)-4-(2-oxoethylidene)-1,2,3,4-tetrahydropyridine-2,6-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| Betalamic acid | KEGG COMPOUND |
| (S-(E))-1,2,3,4-tetrahydro-4-(oxoethylidene)-2,6-pyridinedicarboxylic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:480821 | Beilstein |
| CAS:18766-66-0 | KEGG COMPOUND |
| CAS:18766-66-0 | ChemIDplus |