EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4Se2 |
| Net Charge | 0 |
| Average Mass | 362.146 |
| Monoisotopic Mass | 363.94405 |
| SMILES | NC(CC[Se][Se]CCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16N2O4Se2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14) |
| InChIKey | NBQXBIDZPLKFHR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus sp. (ncbitaxon:1409) | - | PubMed (12003007) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selenohomocystine (CHEBI:27461) has role antibacterial agent (CHEBI:33282) |
| selenohomocystine (CHEBI:27461) has role bacterial metabolite (CHEBI:76969) |
| selenohomocystine (CHEBI:27461) has role marine metabolite (CHEBI:76507) |
| selenohomocystine (CHEBI:27461) is a diselenide (CHEBI:47026) |
| selenohomocystine (CHEBI:27461) is a selenoamino acid (CHEBI:26629) |
| IUPAC Name |
|---|
| 4,4'-diselane-1,2-diylbis(2-aminobutanoic acid) |
| Synonyms | Source |
|---|---|
| 4,4'-diselenobis(2-aminobutanoic acid) | ChemIDplus |
| 4,4'-diselenobis(2-aminobutyric acid) | ChemIDplus |
| selenohomocystine | KEGG COMPOUND |
| Citations |
|---|