EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O5 |
| Net Charge | 0 |
| Average Mass | 348.439 |
| Monoisotopic Mass | 348.19367 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]2(C)CCC[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C20H28O5/c1-11-9-19-10-20(11,25)8-5-12(19)17(2)6-4-7-18(3,16(23)24)14(17)13(19)15(21)22/h12-14,25H,1,4-10H2,2-3H3,(H,21,22)(H,23,24)/t12-,13+,14-,17-,18+,19-,20-/m0/s1 |
| InChIKey | CZEMYYICWZPENF-VOLTXKGXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vicia faba (ncbitaxon:3906) | - | PubMed (24232845) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A53 (CHEBI:27433) has role plant metabolite (CHEBI:76924) |
| gibberellin A53 (CHEBI:27433) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A53 (CHEBI:27433) is a dicarboxylic acid (CHEBI:35692) |
| gibberellin A53 (CHEBI:27433) is conjugate acid of gibberellin A53(2−) (CHEBI:143954) |
| Incoming Relation(s) |
| gibberellin A53 aldehyde (CHEBI:29601) has functional parent gibberellin A53 (CHEBI:27433) |
| gibberellin A53(2−) (CHEBI:143954) is conjugate base of gibberellin A53 (CHEBI:27433) |
| IUPAC Names |
|---|
| (1S,2S,3S,4R,8S,9S,12S)-12-hydroxy-4,8-dimethyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
| 7α-hydroxy-1β,4a-dimethyl-8-methylidene-4aα,4bβ-gibbane-1α,10β-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| (1α,4aα,4bβ,10β)-7-hydroxy-1,4a-dimethyl-8-methylenegibbane-1,10-dicarboxylic acid | IUPAC |
| GA53 | ChEBI |
| gibberellin 53 | ChEBI |
| Gibberellin A53 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000053 | KNApSAcK |
| C06094 | KEGG COMPOUND |
| HMDB0036895 | HMDB |
| LMPR0104170007 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5303959 | Reaxys |
| CAS:51576-08-0 | KEGG COMPOUND |
| Citations |
|---|