EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27421 - 3-hydroxykynurenamine
| Formula | C9H12N2O2 |
| Net Charge | 0 |
| Average Mass | 180.207 |
| Monoisotopic Mass | 180.08988 |
| SMILES | NCCC(=O)c1cccc(O)c1N |
| InChI | InChI=1S/C9H12N2O2/c10-5-4-7(12)6-2-1-3-8(13)9(6)11/h1-3,13H,4-5,10-11H2 |
| InChIKey | ODOPEICAGBYCFH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Homo sapiens (ncbitaxon:9606) | lymph (UBERON:0002391) | PubMed (34290243) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxykynurenamine (CHEBI:27421) has role anti-inflammatory agent (CHEBI:67079) |
| 3-hydroxykynurenamine (CHEBI:27421) has role human metabolite (CHEBI:77746) |
| 3-hydroxykynurenamine (CHEBI:27421) has role immunomodulator (CHEBI:50846) |
| 3-hydroxykynurenamine (CHEBI:27421) is a hydroxykynurenamine (CHEBI:24705) |
| 3-hydroxykynurenamine (CHEBI:27421) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-amino-1-(2-amino-3-hydroxyphenyl)propan-1-one |
| Synonym | Source |
|---|---|
| 3-hydroxy-kynurenamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05636 | KEGG COMPOUND |
| HMDB0060281 | HMDB |
| Citations |
|---|