EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H43N5O7 |
| Net Charge | 0 |
| Average Mass | 477.603 |
| Monoisotopic Mass | 477.31625 |
| SMILES | CNC(C)[C@@H]1CC[C@@H](N)[C@@H](O[C@H]2[C@H](O)[C@@H](O[C@H]3OC[C@](C)(O)[C@H](NC)[C@H]3O)[C@H](N)C[C@@H]2N)O1 |
| InChI | InChI=1S/C21H43N5O7/c1-9(25-3)13-6-5-10(22)19(31-13)32-16-11(23)7-12(24)17(14(16)27)33-20-15(28)18(26-4)21(2,29)8-30-20/h9-20,25-29H,5-8,22-24H2,1-4H3/t9?,10-,11+,12-,13+,14+,15-,16-,17+,18-,19-,20-,21+/m1/s1 |
| InChIKey | CEAZRRDELHUEMR-URQXQFDESA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gentamycin C1 (CHEBI:27412) is a gentamycin C (CHEBI:28417) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R,6S)-4,6-diamino-3-[3-deoxy-4-C-methyl-3-(methylamino)-β-L-arabinopyranosyloxy]-2-hydroxycyclohexyl 2-amino-2,3,4,6,7-pentadeoxy-6-(methylamino)-β-L-lyxo-heptopyranoside |
| Synonyms | Source |
|---|---|
| Gentamicin C1 | KEGG COMPOUND |
| O-2-amino-2,3,4,6,7-pentadeoxy-6-(methylamino)-alpha-D-ribo-heptopyranosyl-(1-4)-O-(3-deoxy-4-C-methyl-3-(methylamino)-beta-L-arabinopyranosyl-(1-6))-2-deoxy-D-streptamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07656 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:25876-10-2 | KEGG COMPOUND |
| CAS:25876-10-2 | ChemIDplus |