EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9N5O |
| Net Charge | 0 |
| Average Mass | 215.216 |
| Monoisotopic Mass | 215.08071 |
| SMILES | c1coc(CNc2ncnc3ncnc23)c1 |
| InChI | InChI=1S/C10H9N5O/c1-2-7(16-3-1)4-11-9-8-10(13-5-12-8)15-6-14-9/h1-3,5-6H,4H2,(H2,11,12,13,14,15) |
| InChIKey | QANMHLXAZMSUEX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kinetin (CHEBI:27407) has role cytokinin (CHEBI:23530) |
| kinetin (CHEBI:27407) has role geroprotector (CHEBI:176497) |
| kinetin (CHEBI:27407) is a 6-aminopurines (CHEBI:20706) |
| kinetin (CHEBI:27407) is a furans (CHEBI:24129) |
| Incoming Relation(s) |
| 9-(α-D-glucosyl)kinetin (CHEBI:72620) has functional parent kinetin (CHEBI:27407) |
| IUPAC Name |
|---|
| N-(furan-2-ylmethyl)-7H-purin-6-amine |
| Synonyms | Source |
|---|---|
| 6-furfuryladenine | ChemIDplus |
| 6-(furfurylamino)purine | ChemIDplus |
| N-furfuryladenine | ChemIDplus |
| N6-furfuryladenine | ChemIDplus |
| N6-(furfurylamino)purine | ChemIDplus |
| kinetin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| kinetin | UniProt |
| Citations |
|---|