EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O3 |
| Net Charge | 0 |
| Average Mass | 116.116 |
| Monoisotopic Mass | 116.04734 |
| SMILES | CCC(=O)CC(=O)O |
| InChI | InChI=1S/C5H8O3/c1-2-4(6)3-5(7)8/h2-3H2,1H3,(H,7,8) |
| InChIKey | FHSUFDYFOHSYHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxopentanoic acid (CHEBI:27401) is a 3-oxo fatty acid (CHEBI:134416) |
| 3-oxopentanoic acid (CHEBI:27401) is a oxopentanoic acid (CHEBI:25799) |
| 3-oxopentanoic acid (CHEBI:27401) is conjugate acid of 3-oxopentanoate (CHEBI:20177) |
| Incoming Relation(s) |
| 3-oxopentanoate (CHEBI:20177) is conjugate base of 3-oxopentanoic acid (CHEBI:27401) |
| IUPAC Name |
|---|
| 3-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 3-Oxopentanoate | KEGG COMPOUND |
| 3-Oxopentanoic acid | KEGG COMPOUND |
| 3-oxovaleric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02233 | KEGG COMPOUND |
| LMFA01060005 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1748703 | Beilstein |